C18H23FN2O3 — CID 71981364
2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl 2-fluorobenzoate (PubChem CID 71981364) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is 2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl 2-fluorobenzoate.
| Compound Name | 2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 71981364 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl 2-fluorobenzoate |
| SMILES | O=C(OCCN1CCN(C(=O)C2CCC2)CC1)c1ccccc1F |
| InChI | InChI=1S/C18H23FN2O3/c19-16-7-2-1-6-15(16)18(23)24-13-12-20-8-10-21(11-9-20)17(22)14-4-3-5-14/h1-2,6-7,14H,3-5,8-13H2 |
| InChIKey | DEFXKBMCEAWVOI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |