C12H12ClN5S — CID 71983404
3-[(5-chlorothiadiazol-4-yl)methyl-(pyridin-2-ylmethyl)amino]propanenitrile (PubChem CID 71983404) has the molecular formula C12H12ClN5S and a molecular weight of 293.78 g/mol. Its IUPAC name is 3-[(5-chlorothiadiazol-4-yl)methyl-(pyridin-2-ylmethyl)amino]propanenitrile.
| Compound Name | 3-[(5-chlorothiadiazol-4-yl)methyl-(pyridin-2-ylmethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 71983404 |
| Molecular Formula | C12H12ClN5S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-[(5-chlorothiadiazol-4-yl)methyl-(pyridin-2-ylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1ccccn1)Cc1nnsc1Cl |
| InChI | InChI=1S/C12H12ClN5S/c13-12-11(16-17-19-12)9-18(7-3-5-14)8-10-4-1-2-6-15-10/h1-2,4,6H,3,7-9H2 |
| InChIKey | HEHJMHUTKGXAHG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |