C26H36N8O — CID 166959421
N-[2-[bis(2-cyanoethyl)amino]ethyl]-2-[3-[bis(pyridin-2-ylmethyl)amino]propylamino]propanamide (PubChem CID 166959421) has the molecular formula C26H36N8O and a molecular weight of 476.63 g/mol. Its IUPAC name is N-[2-[bis(2-cyanoethyl)amino]ethyl]-2-[3-[bis(pyridin-2-ylmethyl)amino]propylamino]propanamide.
| Compound Name | N-[2-[bis(2-cyanoethyl)amino]ethyl]-2-[3-[bis(pyridin-2-ylmethyl)amino]propylamino]propanamide |
|---|---|
| PubChem CID | 166959421 |
| Molecular Formula | C26H36N8O |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | N-[2-[bis(2-cyanoethyl)amino]ethyl]-2-[3-[bis(pyridin-2-ylmethyl)amino]propylamino]propanamide |
| SMILES | CC(NCCCN(Cc1ccccn1)Cc1ccccn1)C(=O)NCCN(CCC#N)CCC#N |
| InChI | InChI=1S/C26H36N8O/c1-23(26(35)32-16-20-33(17-6-11-27)18-7-12-28)29-15-8-19-34(21-24-9-2-4-13-30-24)22-25-10-3-5-14-31-25/h2-5,9-10,13-14,23,29H,6-8,15-22H2,1H3,(H,32,35) |
| InChIKey | WCTVCZMKHNDABL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|