C14H14Cl2N2O3 — CID 71983804
2,2-dichloro-N-[4-methyl-3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]cyclopropane-1-carboxamide (PubChem CID 71983804) has the molecular formula C14H14Cl2N2O3 and a molecular weight of 329.18 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-methyl-3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-methyl-3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71983804 |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2,2-dichloro-N-[4-methyl-3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC2(Cl)Cl)cc1N1CCOC1=O |
| InChI | InChI=1S/C14H14Cl2N2O3/c1-8-2-3-9(17-12(19)10-7-14(10,15)16)6-11(8)18-4-5-21-13(18)20/h2-3,6,10H,4-5,7H2,1H3,(H,17,19) |
| InChIKey | NHOGRSSMHUQVRJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|