C17H19FN4O3 — CID 71986752
1-(3-fluorophenyl)-2-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanol (PubChem CID 71986752) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanol.
| Compound Name | 1-(3-fluorophenyl)-2-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 71986752 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-(3-fluorophenyl)-2-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(NC2CCN(CC(O)c3cccc(F)c3)C2)nc1 |
| InChI | InChI=1S/C17H19FN4O3/c18-13-3-1-2-12(8-13)16(23)11-21-7-6-14(10-21)20-17-5-4-15(9-19-17)22(24)25/h1-5,8-9,14,16,23H,6-7,10-11H2,(H,19,20) |
| InChIKey | YCSIDKHQARRUGP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|