C18H17ClN2O3 — CID 71987180
(5-chloro-2-methylphenyl) 5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxylate (PubChem CID 71987180) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is (5-chloro-2-methylphenyl) 5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxylate.
| Compound Name | (5-chloro-2-methylphenyl) 5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 71987180 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (5-chloro-2-methylphenyl) 5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(Cl)cc1OC(=O)C1CC(=O)N(Cc2ccccn2)C1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-12-5-6-14(19)9-16(12)24-18(23)13-8-17(22)21(10-13)11-15-4-2-3-7-20-15/h2-7,9,13H,8,10-11H2,1H3 |
| InChIKey | TXOYFNLUBHQMLQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|