C17H26N2O3S — CID 71991539
tert-butyl N-[3-[methyl(thiophen-3-ylmethyl)carbamoyl]cyclopentyl]carbamate (PubChem CID 71991539) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is tert-butyl N-[3-[methyl(thiophen-3-ylmethyl)carbamoyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[methyl(thiophen-3-ylmethyl)carbamoyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 71991539 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl N-[3-[methyl(thiophen-3-ylmethyl)carbamoyl]cyclopentyl]carbamate |
| SMILES | CN(Cc1ccsc1)C(=O)C1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,3)22-16(21)18-14-6-5-13(9-14)15(20)19(4)10-12-7-8-23-11-12/h7-8,11,13-14H,5-6,9-10H2,1-4H3,(H,18,21) |
| InChIKey | LLEGBGHURFFOOZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |