C18H18N2O3S — CID 71991540
4-[(2,5-dioxopyrrolidin-3-yl)methyl]-N-methyl-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 71991540) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-3-yl)methyl]-N-methyl-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-3-yl)methyl]-N-methyl-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 71991540 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-3-yl)methyl]-N-methyl-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | CN(Cc1ccsc1)C(=O)c1ccc(CC2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-20(10-13-6-7-24-11-13)18(23)14-4-2-12(3-5-14)8-15-9-16(21)19-17(15)22/h2-7,11,15H,8-10H2,1H3,(H,19,21,22) |
| InChIKey | BQEXOVRMHZSAFE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|