C15H16F3N3O2 — CID 71991819
N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 71991819) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71991819 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)N2CCCC(CO)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3N3O2/c16-15(17,18)13-6-12(4-3-11(13)7-19)20-14(23)21-5-1-2-10(8-21)9-22/h3-4,6,10,22H,1-2,5,8-9H2,(H,20,23) |
| InChIKey | KUZUMRGTZVBKMK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |