C15H19N3O3S — CID 71992076
N-(1-ethylindol-6-yl)-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 71992076) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(1-ethylindol-6-yl)-1,1-dioxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-(1-ethylindol-6-yl)-1,1-dioxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 71992076 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-(1-ethylindol-6-yl)-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | CCn1ccc2ccc(NC(=O)N3CCS(=O)(=O)CC3)cc21 |
| InChI | InChI=1S/C15H19N3O3S/c1-2-17-6-5-12-3-4-13(11-14(12)17)16-15(19)18-7-9-22(20,21)10-8-18/h3-6,11H,2,7-10H2,1H3,(H,16,19) |
| InChIKey | BMUCPQCHVOJBGV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |