C19H20FN3O2 — CID 111446739
1-(1-ethylindol-6-yl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 111446739) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-(1-ethylindol-6-yl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-(1-ethylindol-6-yl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 111446739 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-(1-ethylindol-6-yl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | CCn1ccc2ccc(NC(=O)NCC(O)c3ccccc3F)cc21 |
| InChI | InChI=1S/C19H20FN3O2/c1-2-23-10-9-13-7-8-14(11-17(13)23)22-19(25)21-12-18(24)15-5-3-4-6-16(15)20/h3-11,18,24H,2,12H2,1H3,(H2,21,22,25) |
| InChIKey | HVPPWMOPUCIONO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |