C12H15BrN4O — CID 71994745
4-bromo-N-[(3-ethyl-1H-pyrazol-5-yl)methyl]-1-methylpyrrole-2-carboxamide (PubChem CID 71994745) has the molecular formula C12H15BrN4O and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-bromo-N-[(3-ethyl-1H-pyrazol-5-yl)methyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(3-ethyl-1H-pyrazol-5-yl)methyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71994745 |
| Molecular Formula | C12H15BrN4O |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-bromo-N-[(3-ethyl-1H-pyrazol-5-yl)methyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CCc1cc(CNC(=O)c2cc(Br)cn2C)[nH]n1 |
| InChI | InChI=1S/C12H15BrN4O/c1-3-9-5-10(16-15-9)6-14-12(18)11-4-8(13)7-17(11)2/h4-5,7H,3,6H2,1-2H3,(H,14,18)(H,15,16) |
| InChIKey | CMJACRXVEQRJDH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |