C19H20N2O4 — CID 71997861
2,3,4-trimethoxy-N-[(5-phenyl-1,3-oxazol-2-yl)methyl]aniline (PubChem CID 71997861) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[(5-phenyl-1,3-oxazol-2-yl)methyl]aniline.
| Compound Name | 2,3,4-trimethoxy-N-[(5-phenyl-1,3-oxazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 71997861 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2,3,4-trimethoxy-N-[(5-phenyl-1,3-oxazol-2-yl)methyl]aniline |
| SMILES | COc1ccc(NCc2ncc(-c3ccccc3)o2)c(OC)c1OC |
| InChI | InChI=1S/C19H20N2O4/c1-22-15-10-9-14(18(23-2)19(15)24-3)20-12-17-21-11-16(25-17)13-7-5-4-6-8-13/h4-11,20H,12H2,1-3H3 |
| InChIKey | IHQFLKIXYYPOGB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|