C17H12ClNO5S — CID 7204411
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204411) has the molecular formula C17H12ClNO5S and a molecular weight of 377.81 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204411 |
| Molecular Formula | C17H12ClNO5S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)s1)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H12ClNO5S/c18-14-6-5-13(25-14)12(20)9-24-17(23)10-1-3-11(4-2-10)19-15(21)7-8-16(19)22/h1-6H,7-9H2 |
| InChIKey | BGFRCYLQLLUCMJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|