C21H21N4O3S+ — CID 7206427
(3S,4R,5R,6S)-6-cyclopropyl-6-hydroxy-5-(4-methylpyridin-1-ium-1-yl)-4-(4-nitrophenyl)-2-sulfanylidenepiperidine-3-carbonitrile (PubChem CID 7206427) has the molecular formula C21H21N4O3S+ and a molecular weight of 409.49 g/mol. Its IUPAC name is (3S,4R,5R,6S)-6-cyclopropyl-6-hydroxy-5-(4-methylpyridin-1-ium-1-yl)-4-(4-nitrophenyl)-2-sulfanylidenepiperidine-3-carbonitrile.
| Compound Name | (3S,4R,5R,6S)-6-cyclopropyl-6-hydroxy-5-(4-methylpyridin-1-ium-1-yl)-4-(4-nitrophenyl)-2-sulfanylidenepiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 7206427 |
| Molecular Formula | C21H21N4O3S+ |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (3S,4R,5R,6S)-6-cyclopropyl-6-hydroxy-5-(4-methylpyridin-1-ium-1-yl)-4-(4-nitrophenyl)-2-sulfanylidenepiperidine-3-carbonitrile |
| SMILES | Cc1cc[n+]([C@@H]2[C@@H](c3ccc([N+](=O)[O-])cc3)[C@@H](C#N)C(=S)N[C@]2(O)C2CC2)cc1 |
| InChI | InChI=1S/C21H20N4O3S/c1-13-8-10-24(11-9-13)19-18(14-2-6-16(7-3-14)25(27)28)17(12-22)20(29)23-21(19,26)15-4-5-15/h2-3,6-11,15,17-19,26H,4-5H2,1H3/p+1/t17-,18+,19-,21+/m1/s1 |
| InChIKey | RMSLSPSLQQWXAS-HDAAZOAOSA-O |
| XLogP | 2.68 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|