C23H24F3N3+2 — CID 7210967
1-benzhydryl-4-[4-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium (PubChem CID 7210967) has the molecular formula C23H24F3N3+2 and a molecular weight of 399.46 g/mol. Its IUPAC name is 1-benzhydryl-4-[4-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium.
| Compound Name | 1-benzhydryl-4-[4-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium |
|---|---|
| PubChem CID | 7210967 |
| Molecular Formula | C23H24F3N3+2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-benzhydryl-4-[4-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium |
| SMILES | FC(F)(F)c1cc[nH+]c(N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H22F3N3/c24-23(25,26)20-11-12-27-21(17-20)28-13-15-29(16-14-28)22(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,17,22H,13-16H2/p+2 |
| InChIKey | BBLHFNQYGNUTNT-UHFFFAOYSA-P |
| XLogP | 3.01 |
| TPSA | 21.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |