About 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine
2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine (PubChem CID 7033077) has the molecular formula C25H26N3S+
and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine.
Molecular Properties
| Compound Name | 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine |
| PubChem CID | 7033077 |
| Molecular Formula | C25H26N3S+ |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine |
| SMILES | c1ccc(C(c2ccccc2)[NH+]2CCN(C3=Nc4ccccc4CS3)CC2)cc1 |
| InChI | InChI=1S/C25H25N3S/c1-3-9-20(10-4-1)24(21-11-5-2-6-12-21)27-15-17-28(18-16-27)25-26-23-14-8-7-13-22(23)19-29-25/h1-14,24H,15-19H2/p+1 |
| InChIKey | QACUCHFWWHMICG-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine?
The IUPAC name of 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine (CID 7033077) is 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine.
What is the SMILES notation for 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine?
The canonical SMILES for 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine is c1ccc(C(c2ccccc2)[NH+]2CCN(C3=Nc4ccccc4CS3)CC2)cc1.
What is the InChIKey of 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine?
The InChIKey is QACUCHFWWHMICG-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H25N3S/c1-3-9-20(10-4-1)24(21-11-5-2-6-12-21)27-15-17-28(18-16-27)25-26-23-14-8-7-13-22(23)19-29-25/h1-14,24H,15-19H2/p+1.
What are the key properties of 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine?
2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine has a molecular weight of 400.57 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine is sourced from PubChem (CID 7033077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).