C25H26N3S+ — CID 7033077
2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine (PubChem CID 7033077) has the molecular formula C25H26N3S+ and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine.
| Compound Name | 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine |
|---|---|
| PubChem CID | 7033077 |
| Molecular Formula | C25H26N3S+ |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-4-ium-1-yl)-4H-3,1-benzothiazine |
| SMILES | c1ccc(C(c2ccccc2)[NH+]2CCN(C3=Nc4ccccc4CS3)CC2)cc1 |
| InChI | InChI=1S/C25H25N3S/c1-3-9-20(10-4-1)24(21-11-5-2-6-12-21)27-15-17-28(18-16-27)25-26-23-14-8-7-13-22(23)19-29-25/h1-14,24H,15-19H2/p+1 |
| InChIKey | QACUCHFWWHMICG-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |