C20H21ClN2O2S — CID 7211122
[[(1R,5R)-9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-ylidene]amino] 4-chlorobenzoate (PubChem CID 7211122) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is [[(1R,5R)-9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-ylidene]amino] 4-chlorobenzoate.
| Compound Name | [[(1R,5R)-9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-ylidene]amino] 4-chlorobenzoate |
|---|---|
| PubChem CID | 7211122 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [[(1R,5R)-9-(thiophen-2-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-ylidene]amino] 4-chlorobenzoate |
| SMILES | O=C(ON=C1C[C@H]2CCC[C@H](C1)N2Cc1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O2S/c21-15-8-6-14(7-9-15)20(24)25-22-16-11-17-3-1-4-18(12-16)23(17)13-19-5-2-10-26-19/h2,5-10,17-18H,1,3-4,11-13H2/t17-,18-/m1/s1 |
| InChIKey | PXSDMWHAUNLEMV-QZTJIDSGSA-N |
| XLogP | 5.13 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|