C20H31N3OS — CID 7211982
6-[(4-methoxyphenyl)methylsulfanyl]-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazine (PubChem CID 7211982) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methylsulfanyl]-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazine.
| Compound Name | 6-[(4-methoxyphenyl)methylsulfanyl]-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 7211982 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 6-[(4-methoxyphenyl)methylsulfanyl]-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazine |
| SMILES | COc1ccc(CSC2=NCN([C@@H]3C[C@@H](C)CC(C)(C)C3)CN2)cc1 |
| InChI | InChI=1S/C20H31N3OS/c1-15-9-17(11-20(2,3)10-15)23-13-21-19(22-14-23)25-12-16-5-7-18(24-4)8-6-16/h5-8,15,17H,9-14H2,1-4H3,(H,21,22)/t15-,17-/m1/s1 |
| InChIKey | HIFPBIJDJXXNPN-NVXWUHKLSA-N |
| XLogP | 4.32 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |