C19H24N6O3 — CID 7214260
7-[(2R)-2-hydroxypropyl]-3-methyl-8-[2-(1-phenylbutylidene)hydrazinyl]purine-2,6-dione (PubChem CID 7214260) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 7-[(2R)-2-hydroxypropyl]-3-methyl-8-[2-(1-phenylbutylidene)hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[(2R)-2-hydroxypropyl]-3-methyl-8-[2-(1-phenylbutylidene)hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 7214260 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 7-[(2R)-2-hydroxypropyl]-3-methyl-8-[2-(1-phenylbutylidene)hydrazinyl]purine-2,6-dione |
| SMILES | CCCC(=NNc1nc2c(c(=O)[nH]c(=O)n2C)n1C[C@@H](C)O)c1ccccc1 |
| InChI | InChI=1S/C19H24N6O3/c1-4-8-14(13-9-6-5-7-10-13)22-23-18-20-16-15(25(18)11-12(2)26)17(27)21-19(28)24(16)3/h5-7,9-10,12,26H,4,8,11H2,1-3H3,(H,20,23)(H,21,27,28)/t12-/m1/s1 |
| InChIKey | LNPUADZWVAYRLT-GFCCVEGCSA-N |
| XLogP | 1.42 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|