C20H27N3O5 — CID 7219187
(1S,6S)-6-[(6-methoxy-2-morpholin-4-ylpyridin-1-ium-3-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 7219187) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is (1S,6S)-6-[(6-methoxy-2-morpholin-4-ylpyridin-1-ium-3-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[(6-methoxy-2-morpholin-4-ylpyridin-1-ium-3-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7219187 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (1S,6S)-6-[(6-methoxy-2-morpholin-4-ylpyridin-1-ium-3-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@H]2CC(C)=C(C)C[C@@H]2C(=O)[O-])c(N2CCOCC2)[nH+]1 |
| InChI | InChI=1S/C20H27N3O5/c1-12-10-14(15(20(25)26)11-13(12)2)19(24)21-16-4-5-17(27-3)22-18(16)23-6-8-28-9-7-23/h4-5,14-15H,6-11H2,1-3H3,(H,21,24)(H,25,26)/t14-,15-/m0/s1 |
| InChIKey | DIVFCXSCSKRRAQ-GJZGRUSLSA-N |
| XLogP | 0.40 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|