C12H12NO2- — CID 7219762
3,4,7-trimethyl-1H-indole-2-carboxylate (PubChem CID 7219762) has the molecular formula C12H12NO2- and a molecular weight of 202.23 g/mol. Its IUPAC name is 3,4,7-trimethyl-1H-indole-2-carboxylate.
| Compound Name | 3,4,7-trimethyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7219762 |
| Molecular Formula | C12H12NO2- |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3,4,7-trimethyl-1H-indole-2-carboxylate |
| SMILES | Cc1ccc(C)c2c(C)c(C(=O)[O-])[nH]c12 |
| InChI | InChI=1S/C12H13NO2/c1-6-4-5-7(2)10-9(6)8(3)11(13-10)12(14)15/h4-5,13H,1-3H3,(H,14,15)/p-1 |
| InChIKey | NTLCTUIGGRCPPO-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |