C21H29N3O3S — CID 7220076
6-(butanoylamino)-N-[(2S)-butan-2-yl]-12,12-dimethyl-11-oxa-4-thia-2-azatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-5-carboxamide (PubChem CID 7220076) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 6-(butanoylamino)-N-[(2S)-butan-2-yl]-12,12-dimethyl-11-oxa-4-thia-2-azatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-5-carboxamide.
| Compound Name | 6-(butanoylamino)-N-[(2S)-butan-2-yl]-12,12-dimethyl-11-oxa-4-thia-2-azatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 7220076 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 6-(butanoylamino)-N-[(2S)-butan-2-yl]-12,12-dimethyl-11-oxa-4-thia-2-azatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-5-carboxamide |
| SMILES | CCCC(=O)Nc1c(C(=O)N[C@@H](C)CC)sc2nc3c(cc12)COC(C)(C)C3 |
| InChI | InChI=1S/C21H29N3O3S/c1-6-8-16(25)24-17-14-9-13-11-27-21(4,5)10-15(13)23-20(14)28-18(17)19(26)22-12(3)7-2/h9,12H,6-8,10-11H2,1-5H3,(H,22,26)(H,24,25)/t12-/m0/s1 |
| InChIKey | LXINMFCHCOQRCB-LBPRGKRZSA-N |
| XLogP | 4.41 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |