C23H22O3 — CID 7221754
naphthalen-1-ylmethyl 4-(2,5-dimethylphenyl)-4-oxobutanoate (PubChem CID 7221754) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 4-(2,5-dimethylphenyl)-4-oxobutanoate.
| Compound Name | naphthalen-1-ylmethyl 4-(2,5-dimethylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7221754 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | naphthalen-1-ylmethyl 4-(2,5-dimethylphenyl)-4-oxobutanoate |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)OCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C23H22O3/c1-16-10-11-17(2)21(14-16)22(24)12-13-23(25)26-15-19-8-5-7-18-6-3-4-9-20(18)19/h3-11,14H,12-13,15H2,1-2H3 |
| InChIKey | QSIARKXEAPSGLW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |