C18H22Cl2N2O3 — CID 7222036
(2R)-1-[(Z)-(4,6-dichloro-2H-chromen-3-yl)methylideneamino]oxy-3-piperidin-1-ylpropan-2-ol (PubChem CID 7222036) has the molecular formula C18H22Cl2N2O3 and a molecular weight of 385.29 g/mol. Its IUPAC name is (2R)-1-[(Z)-(4,6-dichloro-2H-chromen-3-yl)methylideneamino]oxy-3-piperidin-1-ylpropan-2-ol.
| Compound Name | (2R)-1-[(Z)-(4,6-dichloro-2H-chromen-3-yl)methylideneamino]oxy-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 7222036 |
| Molecular Formula | C18H22Cl2N2O3 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2R)-1-[(Z)-(4,6-dichloro-2H-chromen-3-yl)methylideneamino]oxy-3-piperidin-1-ylpropan-2-ol |
| SMILES | O[C@@H](CO/N=C\C1=C(Cl)c2cc(Cl)ccc2OC1)CN1CCCCC1 |
| InChI | InChI=1S/C18H22Cl2N2O3/c19-14-4-5-17-16(8-14)18(20)13(11-24-17)9-21-25-12-15(23)10-22-6-2-1-3-7-22/h4-5,8-9,15,23H,1-3,6-7,10-12H2/b21-9-/t15-/m1/s1 |
| InChIKey | UADPAWRTQZECSE-ICFKLBPISA-N |
| XLogP | 3.53 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|