C19H17ClN4OS — CID 7223756
methyl N-benzyl-3-(4-chlorophenyl)-3-oxo-2-(1,2,4-triazol-1-yl)propanimidothioate (PubChem CID 7223756) has the molecular formula C19H17ClN4OS and a molecular weight of 384.89 g/mol. Its IUPAC name is methyl N-benzyl-3-(4-chlorophenyl)-3-oxo-2-(1,2,4-triazol-1-yl)propanimidothioate.
| Compound Name | methyl N-benzyl-3-(4-chlorophenyl)-3-oxo-2-(1,2,4-triazol-1-yl)propanimidothioate |
|---|---|
| PubChem CID | 7223756 |
| Molecular Formula | C19H17ClN4OS |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | methyl N-benzyl-3-(4-chlorophenyl)-3-oxo-2-(1,2,4-triazol-1-yl)propanimidothioate |
| SMILES | CS/C(=N\Cc1ccccc1)C(C(=O)c1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C19H17ClN4OS/c1-26-19(22-11-14-5-3-2-4-6-14)17(24-13-21-12-23-24)18(25)15-7-9-16(20)10-8-15/h2-10,12-13,17H,11H2,1H3/b22-19- |
| InChIKey | ROJOQJFXMRADRT-QOCHGBHMSA-N |
| XLogP | 4.32 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|