C18H17N3O3S — CID 7224452
2-[[(5S)-5-ethyl-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]-N-naphthalen-1-ylacetamide (PubChem CID 7224452) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[[(5S)-5-ethyl-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[[(5S)-5-ethyl-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 7224452 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[[(5S)-5-ethyl-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
| SMILES | CC[C@@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O |
| InChI | InChI=1S/C18H17N3O3S/c1-2-12-16(23)20-18(21-17(12)24)25-10-15(22)19-14-9-5-7-11-6-3-4-8-13(11)14/h3-9,12H,2,10H2,1H3,(H,19,22)(H,20,21,23,24) |
| InChIKey | GHBPBKDCCYAWMN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|