C17H17N3S — CID 7225476
2-[(3-methylphenyl)methylsulfanyl]-4-phenylimidazol-1-amine (PubChem CID 7225476) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methylsulfanyl]-4-phenylimidazol-1-amine.
| Compound Name | 2-[(3-methylphenyl)methylsulfanyl]-4-phenylimidazol-1-amine |
|---|---|
| PubChem CID | 7225476 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-[(3-methylphenyl)methylsulfanyl]-4-phenylimidazol-1-amine |
| SMILES | Cc1cccc(CSc2nc(-c3ccccc3)cn2N)c1 |
| InChI | InChI=1S/C17H17N3S/c1-13-6-5-7-14(10-13)12-21-17-19-16(11-20(17)18)15-8-3-2-4-9-15/h2-11H,12,18H2,1H3 |
| InChIKey | IBKHXODZEJAMOD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |