C20H22ClN6+ — CID 7225537
1-(3-chlorophenyl)-4-[(E)-2-[1-(4-methylphenyl)tetrazol-5-yl]ethenyl]piperazin-4-ium (PubChem CID 7225537) has the molecular formula C20H22ClN6+ and a molecular weight of 381.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[(E)-2-[1-(4-methylphenyl)tetrazol-5-yl]ethenyl]piperazin-4-ium.
| Compound Name | 1-(3-chlorophenyl)-4-[(E)-2-[1-(4-methylphenyl)tetrazol-5-yl]ethenyl]piperazin-4-ium |
|---|---|
| PubChem CID | 7225537 |
| Molecular Formula | C20H22ClN6+ |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[(E)-2-[1-(4-methylphenyl)tetrazol-5-yl]ethenyl]piperazin-4-ium |
| SMILES | Cc1ccc(-n2nnnc2/C=C/[NH+]2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H21ClN6/c1-16-5-7-18(8-6-16)27-20(22-23-24-27)9-10-25-11-13-26(14-12-25)19-4-2-3-17(21)15-19/h2-10,15H,11-14H2,1H3/p+1/b10-9+ |
| InChIKey | BXGYXOJLYFDXTB-MDZDMXLPSA-O |
| XLogP | 2.00 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |