C20H20F3N6+ — CID 7225538
1-[(E)-2-(1-phenyltetrazol-5-yl)ethenyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium (PubChem CID 7225538) has the molecular formula C20H20F3N6+ and a molecular weight of 401.42 g/mol. Its IUPAC name is 1-[(E)-2-(1-phenyltetrazol-5-yl)ethenyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium.
| Compound Name | 1-[(E)-2-(1-phenyltetrazol-5-yl)ethenyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
|---|---|
| PubChem CID | 7225538 |
| Molecular Formula | C20H20F3N6+ |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[(E)-2-(1-phenyltetrazol-5-yl)ethenyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
| SMILES | FC(F)(F)c1cccc(N2CC[NH+](/C=C/c3nnnn3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H19F3N6/c21-20(22,23)16-5-4-8-18(15-16)28-13-11-27(12-14-28)10-9-19-24-25-26-29(19)17-6-2-1-3-7-17/h1-10,15H,11-14H2/p+1/b10-9+ |
| InChIKey | LPYIXKQEUAAUIK-MDZDMXLPSA-O |
| XLogP | 2.06 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |