C23H23N3O4 — CID 7227666
N-[(E)-1-[4-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]ethylideneamino]-2-hydroxybenzamide (PubChem CID 7227666) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(E)-1-[4-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]ethylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(E)-1-[4-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]ethylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 7227666 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[(E)-1-[4-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]ethylideneamino]-2-hydroxybenzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1O)c1ccc(N2C(=O)[C@H]3CCCC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-14(24-25-21(28)19-8-4-5-9-20(19)27)15-10-12-16(13-11-15)26-22(29)17-6-2-3-7-18(17)23(26)30/h4-5,8-13,17-18,27H,2-3,6-7H2,1H3,(H,25,28)/b24-14+/t17-,18+ |
| InChIKey | LBPSOPUFTJZYRK-WWXVOHRASA-N |
| XLogP | 3.23 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|