C19H29N4O4+ — CID 7231878
N-[2-[4-(4-methoxybenzoyl)piperazin-1-ium-1-yl]ethyl]-N'-propan-2-yloxamide (PubChem CID 7231878) has the molecular formula C19H29N4O4+ and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[2-[4-(4-methoxybenzoyl)piperazin-1-ium-1-yl]ethyl]-N'-propan-2-yloxamide.
| Compound Name | N-[2-[4-(4-methoxybenzoyl)piperazin-1-ium-1-yl]ethyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 7231878 |
| Molecular Formula | C19H29N4O4+ |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-[2-[4-(4-methoxybenzoyl)piperazin-1-ium-1-yl]ethyl]-N'-propan-2-yloxamide |
| SMILES | COc1ccc(C(=O)N2CC[NH+](CCNC(=O)C(=O)NC(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O4/c1-14(2)21-18(25)17(24)20-8-9-22-10-12-23(13-11-22)19(26)15-4-6-16(27-3)7-5-15/h4-7,14H,8-13H2,1-3H3,(H,20,24)(H,21,25)/p+1 |
| InChIKey | PLNZMHQRJRCYMB-UHFFFAOYSA-O |
| XLogP | -1.32 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|