C37H35N3O2 — CID 7233362
(2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole (PubChem CID 7233362) has the molecular formula C37H35N3O2 and a molecular weight of 553.71 g/mol. Its IUPAC name is (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole.
| Compound Name | (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole |
|---|---|
| PubChem CID | 7233362 |
| Molecular Formula | C37H35N3O2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole |
| SMILES | CCN1c2cc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc([N+](=O)[O-])c2N(CC)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C37H35N3O2/c1-4-38-33-26-32(27-34(40(41)42)35(33)39(5-2)36(38,3)28-18-10-6-11-19-28)37(29-20-12-7-13-21-29,30-22-14-8-15-23-30)31-24-16-9-17-25-31/h6-27H,4-5H2,1-3H3/t36-/m0/s1 |
| InChIKey | DGMQMJARJPBXLN-BHVANESWSA-N |
| XLogP | 8.52 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|