About (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole
(2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole (PubChem CID 7233362) has the molecular formula C37H35N3O2
and a molecular weight of 553.71 g/mol. Its IUPAC name is (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole.
Molecular Properties
| Compound Name | (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole |
| PubChem CID | 7233362 |
| Molecular Formula | C37H35N3O2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole |
| SMILES | CCN1c2cc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc([N+](=O)[O-])c2N(CC)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C37H35N3O2/c1-4-38-33-26-32(27-34(40(41)42)35(33)39(5-2)36(38,3)28-18-10-6-11-19-28)37(29-20-12-7-13-21-29,30-22-14-8-15-23-30)31-24-16-9-17-25-31/h6-27H,4-5H2,1-3H3/t36-/m0/s1 |
| InChIKey | DGMQMJARJPBXLN-BHVANESWSA-N |
| XLogP | 8.52 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole?
The IUPAC name of (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole (CID 7233362) is (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole.
What is the SMILES notation for (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole?
The canonical SMILES for (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole is CCN1c2cc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc([N+](=O)[O-])c2N(CC)[C@@]1(C)c1ccccc1.
What is the InChIKey of (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole?
The InChIKey is DGMQMJARJPBXLN-BHVANESWSA-N. The full InChI is InChI=1S/C37H35N3O2/c1-4-38-33-26-32(27-34(40(41)42)35(33)39(5-2)36(38,3)28-18-10-6-11-19-28)37(29-20-12-7-13-21-29,30-22-14-8-15-23-30)31-24-16-9-17-25-31/h6-27H,4-5H2,1-3H3/t36-/m0/s1.
What are the key properties of (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole?
(2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole has a molecular weight of 553.71 g/mol, XLogP of 8.52, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,3-diethyl-2-methyl-4-nitro-2-phenyl-6-tritylbenzimidazole is sourced from PubChem (CID 7233362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).