C18H23ClN4O2S — CID 7237038
(2R,3S)-2-(3-chloropropanoylamino)-3-methyl-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 7237038) has the molecular formula C18H23ClN4O2S and a molecular weight of 394.93 g/mol. Its IUPAC name is (2R,3S)-2-(3-chloropropanoylamino)-3-methyl-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | (2R,3S)-2-(3-chloropropanoylamino)-3-methyl-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 7237038 |
| Molecular Formula | C18H23ClN4O2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2R,3S)-2-(3-chloropropanoylamino)-3-methyl-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CC[C@H](C)[C@@H](NC(=O)CCCl)C(=O)Nc1nnc(-c2cccc(C)c2)s1 |
| InChI | InChI=1S/C18H23ClN4O2S/c1-4-12(3)15(20-14(24)8-9-19)16(25)21-18-23-22-17(26-18)13-7-5-6-11(2)10-13/h5-7,10,12,15H,4,8-9H2,1-3H3,(H,20,24)(H,21,23,25)/t12-,15+/m0/s1 |
| InChIKey | NDIMBWQLEZQVSM-SWLSCSKDSA-N |
| XLogP | 3.61 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|