C18H23ClN4O3S — CID 7399289
(2R,3S)-2-(3-chloropropanoylamino)-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-methylpentanamide (PubChem CID 7399289) has the molecular formula C18H23ClN4O3S and a molecular weight of 410.93 g/mol. Its IUPAC name is (2R,3S)-2-(3-chloropropanoylamino)-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-methylpentanamide.
| Compound Name | (2R,3S)-2-(3-chloropropanoylamino)-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 7399289 |
| Molecular Formula | C18H23ClN4O3S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (2R,3S)-2-(3-chloropropanoylamino)-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@@H](NC(=O)CCCl)C(=O)Nc1nnc(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C18H23ClN4O3S/c1-4-11(2)15(20-14(24)9-10-19)16(25)21-18-23-22-17(27-18)12-5-7-13(26-3)8-6-12/h5-8,11,15H,4,9-10H2,1-3H3,(H,20,24)(H,21,23,25)/t11-,15+/m0/s1 |
| InChIKey | ZPIQHHNGKRXWNZ-XHDPSFHLSA-N |
| XLogP | 3.31 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|