C25H39N3O2 — CID 7239016
(2R)-2-ethyl-N-(3-methylbutyl)-N-[(1S)-1-(3-methyl-4-oxoquinazolin-2-yl)propyl]hexanamide (PubChem CID 7239016) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is (2R)-2-ethyl-N-(3-methylbutyl)-N-[(1S)-1-(3-methyl-4-oxoquinazolin-2-yl)propyl]hexanamide.
| Compound Name | (2R)-2-ethyl-N-(3-methylbutyl)-N-[(1S)-1-(3-methyl-4-oxoquinazolin-2-yl)propyl]hexanamide |
|---|---|
| PubChem CID | 7239016 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | (2R)-2-ethyl-N-(3-methylbutyl)-N-[(1S)-1-(3-methyl-4-oxoquinazolin-2-yl)propyl]hexanamide |
| SMILES | CCCC[C@@H](CC)C(=O)N(CCC(C)C)[C@@H](CC)c1nc2ccccc2c(=O)n1C |
| InChI | InChI=1S/C25H39N3O2/c1-7-10-13-19(8-2)24(29)28(17-16-18(4)5)22(9-3)23-26-21-15-12-11-14-20(21)25(30)27(23)6/h11-12,14-15,18-19,22H,7-10,13,16-17H2,1-6H3/t19-,22+/m1/s1 |
| InChIKey | OKHKCGSJAPMMOY-KNQAVFIVSA-N |
| XLogP | 5.48 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |