C10H10N3O3S- — CID 7244817
4-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-2-nitrophenolate (PubChem CID 7244817) has the molecular formula C10H10N3O3S- and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-2-nitrophenolate.
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-2-nitrophenolate |
|---|---|
| PubChem CID | 7244817 |
| Molecular Formula | C10H10N3O3S- |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-2-nitrophenolate |
| SMILES | O=[N+]([O-])c1cc(CSC2=NCCN2)ccc1[O-] |
| InChI | InChI=1S/C10H11N3O3S/c14-9-2-1-7(5-8(9)13(15)16)6-17-10-11-3-4-12-10/h1-2,5,14H,3-4,6H2,(H,11,12)/p-1 |
| InChIKey | AGFWYGFUNPIXDH-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|