C21H21N3O3 — CID 7246827
(3-cyano-4-imino-2-oxopentyl) 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate (PubChem CID 7246827) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
|---|---|
| PubChem CID | 7246827 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1c2c(nc3ccccc13)CCCCC2 |
| InChI | InChI=1S/C21H21N3O3/c1-13(23)16(11-22)19(25)12-27-21(26)20-14-7-3-2-4-9-17(14)24-18-10-6-5-8-15(18)20/h5-6,8,10,16,23H,2-4,7,9,12H2,1H3/b23-13+ |
| InChIKey | MFEZLZOUFAUQMU-YDZHTSKRSA-N |
| XLogP | 3.41 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|