C17H12F3N3O3 — CID 7246973
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 7246973) has the molecular formula C17H12F3N3O3 and a molecular weight of 363.30 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] imidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] imidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 7246973 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cn2ccccc2n1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H12F3N3O3/c1-9(16(24)22-11-6-5-10(18)14(19)15(11)20)26-17(25)12-8-23-7-3-2-4-13(23)21-12/h2-9H,1H3,(H,22,24)/t9-/m1/s1 |
| InChIKey | RPLQGYIZXYUTMF-SECBINFHSA-N |
| XLogP | 2.94 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|