C51H54Cl2O11 — CID 72505100
[4-[[3-[[4-[4-[6-(3-chloropropanoyloxy)hexoxy]benzoyl]oxyphenyl]methylidene]-2-oxocyclopentylidene]methyl]phenyl] 4-[6-(3-chloropropanoyloxy)hexoxy]benzoate (PubChem CID 72505100) has the molecular formula C51H54Cl2O11 and a molecular weight of 913.89 g/mol. Its IUPAC name is [4-[[3-[[4-[4-[6-(3-chloropropanoyloxy)hexoxy]benzoyl]oxyphenyl]methylidene]-2-oxocyclopentylidene]methyl]phenyl] 4-[6-(3-chloropropanoyloxy)hexoxy]benzoate.
| Compound Name | [4-[[3-[[4-[4-[6-(3-chloropropanoyloxy)hexoxy]benzoyl]oxyphenyl]methylidene]-2-oxocyclopentylidene]methyl]phenyl] 4-[6-(3-chloropropanoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 72505100 |
| Molecular Formula | C51H54Cl2O11 |
| Molecular Weight | 913.89 g/mol |
| Exact Mass | 912.30 |
| IUPAC Name | [4-[[3-[[4-[4-[6-(3-chloropropanoyloxy)hexoxy]benzoyl]oxyphenyl]methylidene]-2-oxocyclopentylidene]methyl]phenyl] 4-[6-(3-chloropropanoyloxy)hexoxy]benzoate |
| SMILES | O=C(CCCl)OCCCCCCOc1ccc(C(=O)Oc2ccc(C=C3CCC(=Cc4ccc(OC(=O)c5ccc(OCCCCCCOC(=O)CCCl)cc5)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C51H54Cl2O11/c52-29-27-47(54)61-33-7-3-1-5-31-59-43-23-15-39(16-24-43)50(57)63-45-19-9-37(10-20-45)35-41-13-14-42(49(41)56)36-38-11-21-46(22-12-38)64-51(58)40-17-25-44(26-18-40)60-32-6-2-4-8-34-62-48(55)28-30-53/h9-12,15-26,35-36H,1-8,13-14,27-34H2 |
| InChIKey | DHIRLWXNWFGLII-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.89 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|