C30H34F3N3O4 — CID 72529362
2-[2,2-diethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-[1-methyl-3-(oxan-4-yl)-2-oxo-4H-quinazolin-7-yl]acetamide (PubChem CID 72529362) has the molecular formula C30H34F3N3O4 and a molecular weight of 557.61 g/mol. Its IUPAC name is 2-[2,2-diethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-[1-methyl-3-(oxan-4-yl)-2-oxo-4H-quinazolin-7-yl]acetamide.
| Compound Name | 2-[2,2-diethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-[1-methyl-3-(oxan-4-yl)-2-oxo-4H-quinazolin-7-yl]acetamide |
|---|---|
| PubChem CID | 72529362 |
| Molecular Formula | C30H34F3N3O4 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 2-[2,2-diethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-[1-methyl-3-(oxan-4-yl)-2-oxo-4H-quinazolin-7-yl]acetamide |
| SMILES | CCC1(CC)CC(=CC(=O)Nc2ccc3c(c2)N(C)C(=O)N(C2CCOCC2)C3)c2ccc(C(F)(F)F)cc2O1 |
| InChI | InChI=1S/C30H34F3N3O4/c1-4-29(5-2)17-20(24-9-7-21(30(31,32)33)15-26(24)40-29)14-27(37)34-22-8-6-19-18-36(23-10-12-39-13-11-23)28(38)35(3)25(19)16-22/h6-9,14-16,23H,4-5,10-13,17-18H2,1-3H3,(H,34,37) |
| InChIKey | VVGGTPYLFFQWFA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|