C27H30N2O8 — CID 72544816
(2,5-dioxopyrrolidin-1-yl) 6-[2-[[2-[(E)-N-methoxy-C-methoxycarbonylcarbonimidoyl]phenyl]methoxy]phenyl]hexanoate (PubChem CID 72544816) has the molecular formula C27H30N2O8 and a molecular weight of 510.54 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[2-[[2-[(E)-N-methoxy-C-methoxycarbonylcarbonimidoyl]phenyl]methoxy]phenyl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[[2-[(E)-N-methoxy-C-methoxycarbonylcarbonimidoyl]phenyl]methoxy]phenyl]hexanoate |
|---|---|
| PubChem CID | 72544816 |
| Molecular Formula | C27H30N2O8 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[[2-[(E)-N-methoxy-C-methoxycarbonylcarbonimidoyl]phenyl]methoxy]phenyl]hexanoate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1COc1ccccc1CCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C27H30N2O8/c1-34-27(33)26(28-35-2)21-13-8-6-12-20(21)18-36-22-14-9-7-11-19(22)10-4-3-5-15-25(32)37-29-23(30)16-17-24(29)31/h6-9,11-14H,3-5,10,15-18H2,1-2H3/b28-26+ |
| InChIKey | VLLSDENPLHFSAZ-BYCLXTJYSA-N |
| XLogP | 3.50 |
| TPSA | 120.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|