C22H30O4 — CID 72545441
4,4-dicyclohexyl-8-methyl-1,3-benzodioxine-2-carboxylic acid (PubChem CID 72545441) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 4,4-dicyclohexyl-8-methyl-1,3-benzodioxine-2-carboxylic acid.
| Compound Name | 4,4-dicyclohexyl-8-methyl-1,3-benzodioxine-2-carboxylic acid |
|---|---|
| PubChem CID | 72545441 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 4,4-dicyclohexyl-8-methyl-1,3-benzodioxine-2-carboxylic acid |
| SMILES | Cc1cccc2c1OC(C(=O)O)OC2(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H30O4/c1-15-9-8-14-18-19(15)25-21(20(23)24)26-22(18,16-10-4-2-5-11-16)17-12-6-3-7-13-17/h8-9,14,16-17,21H,2-7,10-13H2,1H3,(H,23,24) |
| InChIKey | YFKGJAVKSKZPSC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |