C22H30O5 — CID 130331905
(4,4-dicyclohexyl-5-methyl-1,3-benzodioxin-2-yl) hydrogen carbonate (PubChem CID 130331905) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (4,4-dicyclohexyl-5-methyl-1,3-benzodioxin-2-yl) hydrogen carbonate.
| Compound Name | (4,4-dicyclohexyl-5-methyl-1,3-benzodioxin-2-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 130331905 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (4,4-dicyclohexyl-5-methyl-1,3-benzodioxin-2-yl) hydrogen carbonate |
| SMILES | Cc1cccc2c1C(C1CCCCC1)(C1CCCCC1)OC(OC(=O)O)O2 |
| InChI | InChI=1S/C22H30O5/c1-15-9-8-14-18-19(15)22(16-10-4-2-5-11-16,17-12-6-3-7-13-17)27-21(25-18)26-20(23)24/h8-9,14,16-17,21H,2-7,10-13H2,1H3,(H,23,24) |
| InChIKey | MQONIUOWVNUIII-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |