C31H52N2O5 — CID 72555938
5-amino-4-hydroxy-7-[[3-(4-methoxybutanoyl)-4-methylphenyl]methyl]-8-methyl-N-(oxan-4-yl)-2-propan-2-ylnonanamide (PubChem CID 72555938) has the molecular formula C31H52N2O5 and a molecular weight of 532.77 g/mol. Its IUPAC name is 5-amino-4-hydroxy-7-[[3-(4-methoxybutanoyl)-4-methylphenyl]methyl]-8-methyl-N-(oxan-4-yl)-2-propan-2-ylnonanamide.
| Compound Name | 5-amino-4-hydroxy-7-[[3-(4-methoxybutanoyl)-4-methylphenyl]methyl]-8-methyl-N-(oxan-4-yl)-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 72555938 |
| Molecular Formula | C31H52N2O5 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | 5-amino-4-hydroxy-7-[[3-(4-methoxybutanoyl)-4-methylphenyl]methyl]-8-methyl-N-(oxan-4-yl)-2-propan-2-ylnonanamide |
| SMILES | COCCCC(=O)c1cc(CC(CC(N)C(O)CC(C(=O)NC2CCOCC2)C(C)C)C(C)C)ccc1C |
| InChI | InChI=1S/C31H52N2O5/c1-20(2)24(16-23-10-9-22(5)27(17-23)29(34)8-7-13-37-6)18-28(32)30(35)19-26(21(3)4)31(36)33-25-11-14-38-15-12-25/h9-10,17,20-21,24-26,28,30,35H,7-8,11-16,18-19,32H2,1-6H3,(H,33,36) |
| InChIKey | JUAUDICTAGPTFD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|