C24H36NO6P — CID 72568143
4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(4-diethoxyphosphorylbut-2-enyl)pyrrolidin-2-one (PubChem CID 72568143) has the molecular formula C24H36NO6P and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(4-diethoxyphosphorylbut-2-enyl)pyrrolidin-2-one.
| Compound Name | 4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(4-diethoxyphosphorylbut-2-enyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 72568143 |
| Molecular Formula | C24H36NO6P |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(4-diethoxyphosphorylbut-2-enyl)pyrrolidin-2-one |
| SMILES | CCOP(=O)(CC=CCN1CC(c2ccc(OC)c(OC3CCCC3)c2)CC1=O)OCC |
| InChI | InChI=1S/C24H36NO6P/c1-4-29-32(27,30-5-2)15-9-8-14-25-18-20(17-24(25)26)19-12-13-22(28-3)23(16-19)31-21-10-6-7-11-21/h8-9,12-13,16,20-21H,4-7,10-11,14-15,17-18H2,1-3H3 |
| InChIKey | QWPDEHFNSKDUQO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|