C18H16FN5O2S — CID 7257659
2-fluoro-N'-[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 7257659) has the molecular formula C18H16FN5O2S and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-fluoro-N'-[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7257659 |
| Molecular Formula | C18H16FN5O2S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-fluoro-N'-[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | Cc1ccccc1-n1cnnc1SCC(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H16FN5O2S/c1-12-6-2-5-9-15(12)24-11-20-23-18(24)27-10-16(25)21-22-17(26)13-7-3-4-8-14(13)19/h2-9,11H,10H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | AOQVKLWZGCERMP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|