C20H19FN4O2S — CID 24577697
N'-[2-[1-(2,4-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-2-fluorobenzohydrazide (PubChem CID 24577697) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is N'-[2-[1-(2,4-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[2-[1-(2,4-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 24577697 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N'-[2-[1-(2,4-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-2-fluorobenzohydrazide |
| SMILES | Cc1ccc(-n2ccnc2SCC(=O)NNC(=O)c2ccccc2F)c(C)c1 |
| InChI | InChI=1S/C20H19FN4O2S/c1-13-7-8-17(14(2)11-13)25-10-9-22-20(25)28-12-18(26)23-24-19(27)15-5-3-4-6-16(15)21/h3-11H,12H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | PSWZSQPGPPUUTH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|