C24H32ClN5O2 — CID 72595714
5-[(5-chloro-2-oxo-5,6-dihydro-1H-indol-3-ylidene)methyl]-N-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 72595714) has the molecular formula C24H32ClN5O2 and a molecular weight of 458.01 g/mol. Its IUPAC name is 5-[(5-chloro-2-oxo-5,6-dihydro-1H-indol-3-ylidene)methyl]-N-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[(5-chloro-2-oxo-5,6-dihydro-1H-indol-3-ylidene)methyl]-N-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 72595714 |
| Molecular Formula | C24H32ClN5O2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 5-[(5-chloro-2-oxo-5,6-dihydro-1H-indol-3-ylidene)methyl]-N-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(C=C2C(=O)NC3=CCC(Cl)C=C32)c(C)c1C(=O)NCCN1CC(C)NC(C)C1 |
| InChI | InChI=1S/C24H32ClN5O2/c1-13-11-30(12-14(2)27-13)8-7-26-24(32)22-15(3)21(28-16(22)4)10-19-18-9-17(25)5-6-20(18)29-23(19)31/h6,9-10,13-14,17,27-28H,5,7-8,11-12H2,1-4H3,(H,26,32)(H,29,31) |
| InChIKey | JRPPIZNHVWEQMJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|