C16H21NO4 — CID 72599770
N-[[2-[1-(1,3-dioxolan-2-yl)-2-methoxyethenyl]phenyl]methoxy]propan-2-imine (PubChem CID 72599770) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[[2-[1-(1,3-dioxolan-2-yl)-2-methoxyethenyl]phenyl]methoxy]propan-2-imine.
| Compound Name | N-[[2-[1-(1,3-dioxolan-2-yl)-2-methoxyethenyl]phenyl]methoxy]propan-2-imine |
|---|---|
| PubChem CID | 72599770 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[[2-[1-(1,3-dioxolan-2-yl)-2-methoxyethenyl]phenyl]methoxy]propan-2-imine |
| SMILES | COC=C(c1ccccc1CON=C(C)C)C1OCCO1 |
| InChI | InChI=1S/C16H21NO4/c1-12(2)17-21-10-13-6-4-5-7-14(13)15(11-18-3)16-19-8-9-20-16/h4-7,11,16H,8-10H2,1-3H3 |
| InChIKey | BRZKEFWSVQSEAS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|